C16H20N3O2S+ — CID 8718114
[2-(4-carbamoylanilino)-2-oxoethyl]-ethyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8718114) has the molecular formula C16H20N3O2S+ and a molecular weight of 318.42 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl]-ethyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl]-ethyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8718114 |
| Molecular Formula | C16H20N3O2S+ |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl]-ethyl-(thiophen-2-ylmethyl)azanium |
| SMILES | CC[NH+](CC(=O)Nc1ccc(C(N)=O)cc1)Cc1cccs1 |
| InChI | InChI=1S/C16H19N3O2S/c1-2-19(10-14-4-3-9-22-14)11-15(20)18-13-7-5-12(6-8-13)16(17)21/h3-9H,2,10-11H2,1H3,(H2,17,21)(H,18,20)/p+1 |
| InChIKey | JLFOCGYKBOEBCO-UHFFFAOYSA-O |
| XLogP | 0.89 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |