C22H25N2OS+ — CID 8717939
[2-(benzhydrylamino)-2-oxoethyl]-ethyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8717939) has the molecular formula C22H25N2OS+ and a molecular weight of 365.52 g/mol. Its IUPAC name is [2-(benzhydrylamino)-2-oxoethyl]-ethyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-(benzhydrylamino)-2-oxoethyl]-ethyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8717939 |
| Molecular Formula | C22H25N2OS+ |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | [2-(benzhydrylamino)-2-oxoethyl]-ethyl-(thiophen-2-ylmethyl)azanium |
| SMILES | CC[NH+](CC(=O)NC(c1ccccc1)c1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C22H24N2OS/c1-2-24(16-20-14-9-15-26-20)17-21(25)23-22(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-15,22H,2,16-17H2,1H3,(H,23,25)/p+1 |
| InChIKey | LLJCVVYUNYUJJC-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |