C19H26N3O2S+ — CID 8906112
ethyl-[2-(4-ethylanilino)-2-oxoethyl]-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium (PubChem CID 8906112) has the molecular formula C19H26N3O2S+ and a molecular weight of 360.50 g/mol. Its IUPAC name is ethyl-[2-(4-ethylanilino)-2-oxoethyl]-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium.
| Compound Name | ethyl-[2-(4-ethylanilino)-2-oxoethyl]-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8906112 |
| Molecular Formula | C19H26N3O2S+ |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | ethyl-[2-(4-ethylanilino)-2-oxoethyl]-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium |
| SMILES | CCc1ccc(NC(=O)C[NH+](CC)CC(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C19H25N3O2S/c1-3-15-7-9-16(10-8-15)21-19(24)14-22(4-2)13-18(23)20-12-17-6-5-11-25-17/h5-11H,3-4,12-14H2,1-2H3,(H,20,23)(H,21,24)/p+1 |
| InChIKey | HYFJGVWEENXCRU-UHFFFAOYSA-O |
| XLogP | 1.47 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |