C22H31N4O2S+ — CID 8592055
ethyl-[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium (PubChem CID 8592055) has the molecular formula C22H31N4O2S+ and a molecular weight of 415.58 g/mol. Its IUPAC name is ethyl-[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium.
| Compound Name | ethyl-[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8592055 |
| Molecular Formula | C22H31N4O2S+ |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | ethyl-[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium |
| SMILES | CC[NH+](CC(=O)NCc1cccs1)CC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H30N4O2S/c1-2-25(16-21(27)23-15-20-7-6-14-29-20)17-22(28)24-18-8-10-19(11-9-18)26-12-4-3-5-13-26/h6-11,14H,2-5,12-13,15-17H2,1H3,(H,23,27)(H,24,28)/p+1 |
| InChIKey | CMXZIXNYCJPFAB-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|