C19H21N2OS3+ — CID 8800916
[2-(2-methylsulfanylanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium (PubChem CID 8800916) has the molecular formula C19H21N2OS3+ and a molecular weight of 389.59 g/mol. Its IUPAC name is [2-(2-methylsulfanylanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-(2-methylsulfanylanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8800916 |
| Molecular Formula | C19H21N2OS3+ |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | [2-(2-methylsulfanylanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium |
| SMILES | CSc1ccccc1NC(=O)C[NH+](Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C19H20N2OS3/c1-23-18-9-3-2-8-17(18)20-19(22)14-21(12-15-6-4-10-24-15)13-16-7-5-11-25-16/h2-11H,12-14H2,1H3,(H,20,22)/p+1 |
| InChIKey | MIMVTYVTWZOONN-UHFFFAOYSA-O |
| XLogP | 3.76 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |