C14H15ClN3O3S+ — CID 8965814
[2-(4-chloro-2-nitroanilino)-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8965814) has the molecular formula C14H15ClN3O3S+ and a molecular weight of 340.81 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8965814 |
| Molecular Formula | C14H15ClN3O3S+ |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-])Cc1cccs1 |
| InChI | InChI=1S/C14H14ClN3O3S/c1-17(8-11-3-2-6-22-11)9-14(19)16-12-5-4-10(15)7-13(12)18(20)21/h2-7H,8-9H2,1H3,(H,16,19)/p+1 |
| InChIKey | PYYWHVWSMVQPIJ-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|