C17H20ClN4O4S+ — CID 8906350
[2-(5-chloro-2-nitroanilino)-2-oxoethyl]-ethyl-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium (PubChem CID 8906350) has the molecular formula C17H20ClN4O4S+ and a molecular weight of 411.89 g/mol. Its IUPAC name is [2-(5-chloro-2-nitroanilino)-2-oxoethyl]-ethyl-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium.
| Compound Name | [2-(5-chloro-2-nitroanilino)-2-oxoethyl]-ethyl-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8906350 |
| Molecular Formula | C17H20ClN4O4S+ |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | [2-(5-chloro-2-nitroanilino)-2-oxoethyl]-ethyl-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium |
| SMILES | CC[NH+](CC(=O)NCc1cccs1)CC(=O)Nc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19ClN4O4S/c1-2-21(10-16(23)19-9-13-4-3-7-27-13)11-17(24)20-14-8-12(18)5-6-15(14)22(25)26/h3-8H,2,9-11H2,1H3,(H,19,23)(H,20,24)/p+1 |
| InChIKey | VAELAQMRIBXLAB-UHFFFAOYSA-O |
| XLogP | 1.47 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|