C15H18ClN2OS+ — CID 8965954
[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8965954) has the molecular formula C15H18ClN2OS+ and a molecular weight of 309.84 g/mol. Its IUPAC name is [2-[(3-chlorophenyl)methylamino]-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-[(3-chlorophenyl)methylamino]-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8965954 |
| Molecular Formula | C15H18ClN2OS+ |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | [2-[(3-chlorophenyl)methylamino]-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium |
| SMILES | C[NH+](CC(=O)NCc1cccc(Cl)c1)Cc1cccs1 |
| InChI | InChI=1S/C15H17ClN2OS/c1-18(10-14-6-3-7-20-14)11-15(19)17-9-12-4-2-5-13(16)8-12/h2-8H,9-11H2,1H3,(H,17,19)/p+1 |
| InChIKey | NBGCGDOEIAITIM-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |