C29H38N4OS — CID 42468339
N-[4-[4-[3-(4-methyl-1,3-thiazol-5-yl)propylamino]piperidin-1-yl]phenyl]-5-phenylpentanamide (PubChem CID 42468339) has the molecular formula C29H38N4OS and a molecular weight of 490.72 g/mol. Its IUPAC name is N-[4-[4-[3-(4-methyl-1,3-thiazol-5-yl)propylamino]piperidin-1-yl]phenyl]-5-phenylpentanamide.
| Compound Name | N-[4-[4-[3-(4-methyl-1,3-thiazol-5-yl)propylamino]piperidin-1-yl]phenyl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 42468339 |
| Molecular Formula | C29H38N4OS |
| Molecular Weight | 490.72 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | N-[4-[4-[3-(4-methyl-1,3-thiazol-5-yl)propylamino]piperidin-1-yl]phenyl]-5-phenylpentanamide |
| SMILES | Cc1ncsc1CCCNC1CCN(c2ccc(NC(=O)CCCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H38N4OS/c1-23-28(35-22-31-23)11-7-19-30-25-17-20-33(21-18-25)27-15-13-26(14-16-27)32-29(34)12-6-5-10-24-8-3-2-4-9-24/h2-4,8-9,13-16,22,25,30H,5-7,10-12,17-21H2,1H3,(H,32,34) |
| InChIKey | DWONVHOWJDXQSV-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.72 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|