C25H33N3O3 — CID 45177864
N-[4-[4-(1,4-dioxan-2-ylmethylamino)piperidin-1-yl]phenyl]-3-phenylpropanamide (PubChem CID 45177864) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-[4-[4-(1,4-dioxan-2-ylmethylamino)piperidin-1-yl]phenyl]-3-phenylpropanamide.
| Compound Name | N-[4-[4-(1,4-dioxan-2-ylmethylamino)piperidin-1-yl]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 45177864 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N-[4-[4-(1,4-dioxan-2-ylmethylamino)piperidin-1-yl]phenyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(N2CCC(NCC3COCCO3)CC2)cc1 |
| InChI | InChI=1S/C25H33N3O3/c29-25(11-6-20-4-2-1-3-5-20)27-22-7-9-23(10-8-22)28-14-12-21(13-15-28)26-18-24-19-30-16-17-31-24/h1-5,7-10,21,24,26H,6,11-19H2,(H,27,29) |
| InChIKey | IMCLTCMMTFHOQW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|