C22H28N2O — CID 112985401
N-[4-(4-benzylpiperidin-1-yl)phenyl]butanamide (PubChem CID 112985401) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is N-[4-(4-benzylpiperidin-1-yl)phenyl]butanamide.
| Compound Name | N-[4-(4-benzylpiperidin-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 112985401 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-[4-(4-benzylpiperidin-1-yl)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H28N2O/c1-2-6-22(25)23-20-9-11-21(12-10-20)24-15-13-19(14-16-24)17-18-7-4-3-5-8-18/h3-5,7-12,19H,2,6,13-17H2,1H3,(H,23,25) |
| InChIKey | GTGRCOVGRJQNOA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|