C22H29N3O — CID 113030633
N-[5-(4-benzylpiperidin-1-yl)-2-pyridinyl]pentanamide (PubChem CID 113030633) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[5-(4-benzylpiperidin-1-yl)-2-pyridinyl]pentanamide.
| Compound Name | N-[5-(4-benzylpiperidin-1-yl)-2-pyridinyl]pentanamide |
|---|---|
| PubChem CID | 113030633 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-[5-(4-benzylpiperidin-1-yl)-2-pyridinyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(N2CCC(Cc3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C22H29N3O/c1-2-3-9-22(26)24-21-11-10-20(17-23-21)25-14-12-19(13-15-25)16-18-7-5-4-6-8-18/h4-8,10-11,17,19H,2-3,9,12-16H2,1H3,(H,23,24,26) |
| InChIKey | NFXAXMKCKMSLFD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |