C31H37N3O2 — CID 3879106
2-(4-benzylpiperidin-1-yl)-5-(butanoylamino)-N-(2-phenylethyl)benzamide (PubChem CID 3879106) has the molecular formula C31H37N3O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-(butanoylamino)-N-(2-phenylethyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-(butanoylamino)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 3879106 |
| Molecular Formula | C31H37N3O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-(butanoylamino)-N-(2-phenylethyl)benzamide |
| SMILES | CCCC(=O)Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C31H37N3O2/c1-2-9-30(35)33-27-14-15-29(28(23-27)31(36)32-19-16-24-10-5-3-6-11-24)34-20-17-26(18-21-34)22-25-12-7-4-8-13-25/h3-8,10-15,23,26H,2,9,16-22H2,1H3,(H,32,36)(H,33,35) |
| InChIKey | UWYMWJUXZJQUFY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|