C32H40N4O2 — CID 4018849
2-(4-benzylpiperidin-1-yl)-5-(heptanoylamino)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 4018849) has the molecular formula C32H40N4O2 and a molecular weight of 512.70 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-(heptanoylamino)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-(heptanoylamino)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4018849 |
| Molecular Formula | C32H40N4O2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-(heptanoylamino)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCCCCCC(=O)Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCc2cccnc2)c1 |
| InChI | InChI=1S/C32H40N4O2/c1-2-3-4-8-13-31(37)35-28-14-15-30(29(22-28)32(38)34-24-27-12-9-18-33-23-27)36-19-16-26(17-20-36)21-25-10-6-5-7-11-25/h5-7,9-12,14-15,18,22-23,26H,2-4,8,13,16-17,19-21,24H2,1H3,(H,34,38)(H,35,37) |
| InChIKey | APNANUXBFGITRH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|