C32H31N5O4 — CID 1054200
2-(4-benzylpiperidin-1-yl)-5-[(4-nitrobenzoyl)amino]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 1054200) has the molecular formula C32H31N5O4 and a molecular weight of 549.63 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(4-nitrobenzoyl)amino]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-nitrobenzoyl)amino]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 1054200 |
| Molecular Formula | C32H31N5O4 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-nitrobenzoyl)amino]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCc2cccnc2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H31N5O4/c38-31(26-8-11-28(12-9-26)37(40)41)35-27-10-13-30(29(20-27)32(39)34-22-25-7-4-16-33-21-25)36-17-14-24(15-18-36)19-23-5-2-1-3-6-23/h1-13,16,20-21,24H,14-15,17-19,22H2,(H,34,39)(H,35,38) |
| InChIKey | QNQLYOCQEWFPJZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|