C32H31BrN4O2 — CID 3255178
2-(4-benzylpiperidin-1-yl)-5-[(4-bromobenzoyl)amino]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 3255178) has the molecular formula C32H31BrN4O2 and a molecular weight of 583.53 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(4-bromobenzoyl)amino]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-bromobenzoyl)amino]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3255178 |
| Molecular Formula | C32H31BrN4O2 |
| Molecular Weight | 583.53 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-bromobenzoyl)amino]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCc2cccnc2)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C32H31BrN4O2/c33-27-10-8-26(9-11-27)31(38)36-28-12-13-30(29(20-28)32(39)35-22-25-7-4-16-34-21-25)37-17-14-24(15-18-37)19-23-5-2-1-3-6-23/h1-13,16,20-21,24H,14-15,17-19,22H2,(H,35,39)(H,36,38) |
| InChIKey | GPXIERJIVCMDBB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.53 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|