C30H34ClN3O2 — CID 92967322
2-(4-benzylpiperidin-1-yl)-5-[[(2R)-2-chloropropanoyl]amino]-N-(2-phenylethyl)benzamide (PubChem CID 92967322) has the molecular formula C30H34ClN3O2 and a molecular weight of 504.07 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[[(2R)-2-chloropropanoyl]amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[[(2R)-2-chloropropanoyl]amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 92967322 |
| Molecular Formula | C30H34ClN3O2 |
| Molecular Weight | 504.07 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[[(2R)-2-chloropropanoyl]amino]-N-(2-phenylethyl)benzamide |
| SMILES | C[C@@H](Cl)C(=O)Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C30H34ClN3O2/c1-22(31)29(35)33-26-12-13-28(27(21-26)30(36)32-17-14-23-8-4-2-5-9-23)34-18-15-25(16-19-34)20-24-10-6-3-7-11-24/h2-13,21-22,25H,14-20H2,1H3,(H,32,36)(H,33,35)/t22-/m1/s1 |
| InChIKey | PZVHLPMMJIEHBM-JOCHJYFZSA-N |
| XLogP | 5.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.07 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|