C30H34FN3O2 — CID 4587534
2-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-5-(2-methylpropanoylamino)benzamide (PubChem CID 4587534) has the molecular formula C30H34FN3O2 and a molecular weight of 487.62 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-5-(2-methylpropanoylamino)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-5-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 4587534 |
| Molecular Formula | C30H34FN3O2 |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-5-(2-methylpropanoylamino)benzamide |
| SMILES | CC(C)C(=O)Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C30H34FN3O2/c1-21(2)29(35)33-26-12-13-28(27(19-26)30(36)32-20-24-8-10-25(31)11-9-24)34-16-14-23(15-17-34)18-22-6-4-3-5-7-22/h3-13,19,21,23H,14-18,20H2,1-2H3,(H,32,36)(H,33,35) |
| InChIKey | FPRDZWPFPNLUDO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|