C39H44FN3O2 — CID 42663016
2-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-5-[(4-hexylbenzoyl)amino]benzamide (PubChem CID 42663016) has the molecular formula C39H44FN3O2 and a molecular weight of 605.80 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-5-[(4-hexylbenzoyl)amino]benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-5-[(4-hexylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 42663016 |
| Molecular Formula | C39H44FN3O2 |
| Molecular Weight | 605.80 g/mol |
| Exact Mass | 605.34 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-5-[(4-hexylbenzoyl)amino]benzamide |
| SMILES | CCCCCCc1ccc(C(=O)Nc2ccc(N3CCC(Cc4ccccc4)CC3)c(C(=O)NCc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C39H44FN3O2/c1-2-3-4-6-9-29-12-16-33(17-13-29)38(44)42-35-20-21-37(36(27-35)39(45)41-28-32-14-18-34(40)19-15-32)43-24-22-31(23-25-43)26-30-10-7-5-8-11-30/h5,7-8,10-21,27,31H,2-4,6,9,22-26,28H2,1H3,(H,41,45)(H,42,44) |
| InChIKey | BKGXBMBMQINJGI-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.80 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|