C36H45N3O2 — CID 4014189
N-[4-(4-benzylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]-4-pentylbenzamide (PubChem CID 4014189) has the molecular formula C36H45N3O2 and a molecular weight of 551.78 g/mol. Its IUPAC name is N-[4-(4-benzylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]-4-pentylbenzamide.
| Compound Name | N-[4-(4-benzylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 4014189 |
| Molecular Formula | C36H45N3O2 |
| Molecular Weight | 551.78 g/mol |
| Exact Mass | 551.35 |
| IUPAC Name | N-[4-(4-benzylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccc(N3CCC(Cc4ccccc4)CC3)c(C(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C36H45N3O2/c1-2-3-6-11-28-14-16-31(17-15-28)35(40)37-32-18-19-34(33(27-32)36(41)39-22-9-5-10-23-39)38-24-20-30(21-25-38)26-29-12-7-4-8-13-29/h4,7-8,12-19,27,30H,2-3,5-6,9-11,20-26H2,1H3,(H,37,40) |
| InChIKey | PXNQPKXIECYIIO-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.78 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|