C30H31Cl2N3O2 — CID 3993970
N-[4-(4-benzylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-2,4-dichlorobenzamide (PubChem CID 3993970) has the molecular formula C30H31Cl2N3O2 and a molecular weight of 536.50 g/mol. Its IUPAC name is N-[4-(4-benzylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[4-(4-benzylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 3993970 |
| Molecular Formula | C30H31Cl2N3O2 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | N-[4-(4-benzylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-2,4-dichlorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)N2CCCC2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H31Cl2N3O2/c31-23-8-10-25(27(32)19-23)29(36)33-24-9-11-28(26(20-24)30(37)35-14-4-5-15-35)34-16-12-22(13-17-34)18-21-6-2-1-3-7-21/h1-3,6-11,19-20,22H,4-5,12-18H2,(H,33,36) |
| InChIKey | ZOMDBTLGMHWKEA-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|