C30H33FN4O2 — CID 1054391
1-[4-(4-benzylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-3-(2-fluorophenyl)urea (PubChem CID 1054391) has the molecular formula C30H33FN4O2 and a molecular weight of 500.62 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[4-(4-benzylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 1054391 |
| Molecular Formula | C30H33FN4O2 |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 1-[4-(4-benzylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-3-(2-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)N2CCCC2)c1)Nc1ccccc1F |
| InChI | InChI=1S/C30H33FN4O2/c31-26-10-4-5-11-27(26)33-30(37)32-24-12-13-28(25(21-24)29(36)35-16-6-7-17-35)34-18-14-23(15-19-34)20-22-8-2-1-3-9-22/h1-5,8-13,21,23H,6-7,14-20H2,(H2,32,33,37) |
| InChIKey | LRHMAHNKYWRNCV-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|