C33H41N3O3 — CID 4545096
2-(4-benzylpiperidin-1-yl)-5-[(4-butoxybenzoyl)amino]-N-propan-2-ylbenzamide (PubChem CID 4545096) has the molecular formula C33H41N3O3 and a molecular weight of 527.71 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(4-butoxybenzoyl)amino]-N-propan-2-ylbenzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-butoxybenzoyl)amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 4545096 |
| Molecular Formula | C33H41N3O3 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-butoxybenzoyl)amino]-N-propan-2-ylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(N3CCC(Cc4ccccc4)CC3)c(C(=O)NC(C)C)c2)cc1 |
| InChI | InChI=1S/C33H41N3O3/c1-4-5-21-39-29-14-11-27(12-15-29)32(37)35-28-13-16-31(30(23-28)33(38)34-24(2)3)36-19-17-26(18-20-36)22-25-9-7-6-8-10-25/h6-16,23-24,26H,4-5,17-22H2,1-3H3,(H,34,38)(H,35,37) |
| InChIKey | SFDZKNTUCHKTHI-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|