C30H35N3O2 — CID 3408766
2-(4-benzylpiperidin-1-yl)-5-[(2-methylbenzoyl)amino]-N-propan-2-ylbenzamide (PubChem CID 3408766) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(2-methylbenzoyl)amino]-N-propan-2-ylbenzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(2-methylbenzoyl)amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 3408766 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(2-methylbenzoyl)amino]-N-propan-2-ylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C30H35N3O2/c1-21(2)31-30(35)27-20-25(32-29(34)26-12-8-7-9-22(26)3)13-14-28(27)33-17-15-24(16-18-33)19-23-10-5-4-6-11-23/h4-14,20-21,24H,15-19H2,1-3H3,(H,31,35)(H,32,34) |
| InChIKey | XUQIBNVITUUZGX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|