C21H24N2O3 — CID 50807328
5-[(2-methylbenzoyl)amino]-2-(4-methylpiperidin-1-yl)benzoic acid (PubChem CID 50807328) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 5-[(2-methylbenzoyl)amino]-2-(4-methylpiperidin-1-yl)benzoic acid.
| Compound Name | 5-[(2-methylbenzoyl)amino]-2-(4-methylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 50807328 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 5-[(2-methylbenzoyl)amino]-2-(4-methylpiperidin-1-yl)benzoic acid |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-14-9-11-23(12-10-14)19-8-7-16(13-18(19)21(25)26)22-20(24)17-6-4-3-5-15(17)2/h3-8,13-14H,9-12H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | KELCLYFNMZTKAI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|