C36H46N4O3 — CID 3994416
4-hexyl-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzamide (PubChem CID 3994416) has the molecular formula C36H46N4O3 and a molecular weight of 582.79 g/mol. Its IUPAC name is 4-hexyl-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 4-hexyl-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 3994416 |
| Molecular Formula | C36H46N4O3 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | 4-hexyl-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzamide |
| SMILES | CCCCCCc1ccc(C(=O)Nc2ccc(N3CCN(c4ccccc4OC)CC3)c(C(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C36H46N4O3/c1-3-4-5-7-12-28-15-17-29(18-16-28)35(41)37-30-19-20-32(31(27-30)36(42)40-21-10-6-11-22-40)38-23-25-39(26-24-38)33-13-8-9-14-34(33)43-2/h8-9,13-20,27H,3-7,10-12,21-26H2,1-2H3,(H,37,41) |
| InChIKey | HROAHGPOEQFUIA-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|