C34H40N4O4 — CID 98292724
4-methoxy-N-[4-[4-[(2R)-2-phenylbutanoyl]piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzamide (PubChem CID 98292724) has the molecular formula C34H40N4O4 and a molecular weight of 568.72 g/mol. Its IUPAC name is 4-methoxy-N-[4-[4-[(2R)-2-phenylbutanoyl]piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 4-methoxy-N-[4-[4-[(2R)-2-phenylbutanoyl]piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 98292724 |
| Molecular Formula | C34H40N4O4 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 4-methoxy-N-[4-[4-[(2R)-2-phenylbutanoyl]piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzamide |
| SMILES | CC[C@@H](C(=O)N1CCN(c2ccc(NC(=O)c3ccc(OC)cc3)cc2C(=O)N2CCCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C34H40N4O4/c1-3-29(25-10-6-4-7-11-25)33(40)38-22-20-36(21-23-38)31-17-14-27(24-30(31)34(41)37-18-8-5-9-19-37)35-32(39)26-12-15-28(42-2)16-13-26/h4,6-7,10-17,24,29H,3,5,8-9,18-23H2,1-2H3,(H,35,39)/t29-/m1/s1 |
| InChIKey | SZJPAJWGYSBJDF-GDLZYMKVSA-N |
| XLogP | 5.42 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|