C30H40N4O3 — CID 93139472
3-methyl-N-[4-[4-[(2S)-2-phenylbutanoyl]piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]butanamide (PubChem CID 93139472) has the molecular formula C30H40N4O3 and a molecular weight of 504.68 g/mol. Its IUPAC name is 3-methyl-N-[4-[4-[(2S)-2-phenylbutanoyl]piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]butanamide.
| Compound Name | 3-methyl-N-[4-[4-[(2S)-2-phenylbutanoyl]piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]butanamide |
|---|---|
| PubChem CID | 93139472 |
| Molecular Formula | C30H40N4O3 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | 3-methyl-N-[4-[4-[(2S)-2-phenylbutanoyl]piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]butanamide |
| SMILES | CC[C@H](C(=O)N1CCN(c2ccc(NC(=O)CC(C)C)cc2C(=O)N2CCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C30H40N4O3/c1-4-25(23-10-6-5-7-11-23)29(36)34-18-16-32(17-19-34)27-13-12-24(31-28(35)20-22(2)3)21-26(27)30(37)33-14-8-9-15-33/h5-7,10-13,21-22,25H,4,8-9,14-20H2,1-3H3,(H,31,35)/t25-/m0/s1 |
| InChIKey | RHDKJYGXAMWVSW-VWLOTQADSA-N |
| XLogP | 4.75 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|