C33H40N4O4 — CID 42675395
N-benzyl-5-[(2-methoxyacetyl)amino]-N-methyl-2-[4-(2-phenylbutanoyl)-1,4-diazepan-1-yl]benzamide (PubChem CID 42675395) has the molecular formula C33H40N4O4 and a molecular weight of 556.71 g/mol. Its IUPAC name is N-benzyl-5-[(2-methoxyacetyl)amino]-N-methyl-2-[4-(2-phenylbutanoyl)-1,4-diazepan-1-yl]benzamide.
| Compound Name | N-benzyl-5-[(2-methoxyacetyl)amino]-N-methyl-2-[4-(2-phenylbutanoyl)-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 42675395 |
| Molecular Formula | C33H40N4O4 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | N-benzyl-5-[(2-methoxyacetyl)amino]-N-methyl-2-[4-(2-phenylbutanoyl)-1,4-diazepan-1-yl]benzamide |
| SMILES | CCC(C(=O)N1CCCN(c2ccc(NC(=O)COC)cc2C(=O)N(C)Cc2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C33H40N4O4/c1-4-28(26-14-9-6-10-15-26)33(40)37-19-11-18-36(20-21-37)30-17-16-27(34-31(38)24-41-3)22-29(30)32(39)35(2)23-25-12-7-5-8-13-25/h5-10,12-17,22,28H,4,11,18-21,23-24H2,1-3H3,(H,34,38) |
| InChIKey | XDLZPRSTMWATHD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|