C31H35FN4O4 — CID 42678149
N-[(4-fluorophenyl)methyl]-5-[(2-methoxyacetyl)amino]-2-[4-(2-phenylbutanoyl)piperazin-1-yl]benzamide (PubChem CID 42678149) has the molecular formula C31H35FN4O4 and a molecular weight of 546.64 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-5-[(2-methoxyacetyl)amino]-2-[4-(2-phenylbutanoyl)piperazin-1-yl]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-5-[(2-methoxyacetyl)amino]-2-[4-(2-phenylbutanoyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42678149 |
| Molecular Formula | C31H35FN4O4 |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-5-[(2-methoxyacetyl)amino]-2-[4-(2-phenylbutanoyl)piperazin-1-yl]benzamide |
| SMILES | CCC(C(=O)N1CCN(c2ccc(NC(=O)COC)cc2C(=O)NCc2ccc(F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C31H35FN4O4/c1-3-26(23-7-5-4-6-8-23)31(39)36-17-15-35(16-18-36)28-14-13-25(34-29(37)21-40-2)19-27(28)30(38)33-20-22-9-11-24(32)12-10-22/h4-14,19,26H,3,15-18,20-21H2,1-2H3,(H,33,38)(H,34,37) |
| InChIKey | FZXWDOZTACDLEZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|