C29H32F2N4O3 — CID 42679881
N-[(4-fluorophenyl)methyl]-2-[4-[(2-fluorophenyl)methyl]-1,4-diazepan-1-yl]-5-[(2-methoxyacetyl)amino]benzamide (PubChem CID 42679881) has the molecular formula C29H32F2N4O3 and a molecular weight of 522.60 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[4-[(2-fluorophenyl)methyl]-1,4-diazepan-1-yl]-5-[(2-methoxyacetyl)amino]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[4-[(2-fluorophenyl)methyl]-1,4-diazepan-1-yl]-5-[(2-methoxyacetyl)amino]benzamide |
|---|---|
| PubChem CID | 42679881 |
| Molecular Formula | C29H32F2N4O3 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[4-[(2-fluorophenyl)methyl]-1,4-diazepan-1-yl]-5-[(2-methoxyacetyl)amino]benzamide |
| SMILES | COCC(=O)Nc1ccc(N2CCCN(Cc3ccccc3F)CC2)c(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C29H32F2N4O3/c1-38-20-28(36)33-24-11-12-27(25(17-24)29(37)32-18-21-7-9-23(30)10-8-21)35-14-4-13-34(15-16-35)19-22-5-2-3-6-26(22)31/h2-3,5-12,17H,4,13-16,18-20H2,1H3,(H,32,37)(H,33,36) |
| InChIKey | HMWBPIHNTYTUIL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|