C29H30F2N4O4 — CID 42678242
2-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-N-[(4-fluorophenyl)methyl]-5-[(2-methoxyacetyl)amino]benzamide (PubChem CID 42678242) has the molecular formula C29H30F2N4O4 and a molecular weight of 536.58 g/mol. Its IUPAC name is 2-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-N-[(4-fluorophenyl)methyl]-5-[(2-methoxyacetyl)amino]benzamide.
| Compound Name | 2-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-N-[(4-fluorophenyl)methyl]-5-[(2-methoxyacetyl)amino]benzamide |
|---|---|
| PubChem CID | 42678242 |
| Molecular Formula | C29H30F2N4O4 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 2-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]-N-[(4-fluorophenyl)methyl]-5-[(2-methoxyacetyl)amino]benzamide |
| SMILES | COCC(=O)Nc1ccc(N2CCCN(C(=O)c3cccc(F)c3)CC2)c(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C29H30F2N4O4/c1-39-19-27(36)33-24-10-11-26(25(17-24)28(37)32-18-20-6-8-22(30)9-7-20)34-12-3-13-35(15-14-34)29(38)21-4-2-5-23(31)16-21/h2,4-11,16-17H,3,12-15,18-19H2,1H3,(H,32,37)(H,33,36) |
| InChIKey | QYFZWYARDNNLLA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|