C32H31FN4O4S — CID 42678165
N-[3-[(4-fluorophenyl)methylcarbamoyl]-4-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide (PubChem CID 42678165) has the molecular formula C32H31FN4O4S and a molecular weight of 586.69 g/mol. Its IUPAC name is N-[3-[(4-fluorophenyl)methylcarbamoyl]-4-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(4-fluorophenyl)methylcarbamoyl]-4-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42678165 |
| Molecular Formula | C32H31FN4O4S |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | N-[3-[(4-fluorophenyl)methylcarbamoyl]-4-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCCN(c3ccc(NC(=O)c4cccs4)cc3C(=O)NCc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H31FN4O4S/c1-41-26-12-7-23(8-13-26)32(40)37-16-3-15-36(17-18-37)28-14-11-25(35-31(39)29-4-2-19-42-29)20-27(28)30(38)34-21-22-5-9-24(33)10-6-22/h2,4-14,19-20H,3,15-18,21H2,1H3,(H,34,38)(H,35,39) |
| InChIKey | VGCCGCUOCCHEAG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|