C35H35FN4O4 — CID 42678204
N-[(4-fluorophenyl)methyl]-5-[(3-methoxybenzoyl)amino]-2-[4-(4-methylbenzoyl)-1,4-diazepan-1-yl]benzamide (PubChem CID 42678204) has the molecular formula C35H35FN4O4 and a molecular weight of 594.69 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-5-[(3-methoxybenzoyl)amino]-2-[4-(4-methylbenzoyl)-1,4-diazepan-1-yl]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-5-[(3-methoxybenzoyl)amino]-2-[4-(4-methylbenzoyl)-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 42678204 |
| Molecular Formula | C35H35FN4O4 |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-5-[(3-methoxybenzoyl)amino]-2-[4-(4-methylbenzoyl)-1,4-diazepan-1-yl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(N3CCCN(C(=O)c4ccc(C)cc4)CC3)c(C(=O)NCc3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C35H35FN4O4/c1-24-7-11-26(12-8-24)35(43)40-18-4-17-39(19-20-40)32-16-15-29(38-33(41)27-5-3-6-30(21-27)44-2)22-31(32)34(42)37-23-25-9-13-28(36)14-10-25/h3,5-16,21-22H,4,17-20,23H2,1-2H3,(H,37,42)(H,38,41) |
| InChIKey | BNTWZZOFRJEFNH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|