C36H37FN4O4 — CID 98198614
N-[(4-fluorophenyl)methyl]-5-[(3-methoxybenzoyl)amino]-2-[4-[(2R)-2-phenylbutanoyl]piperazin-1-yl]benzamide (PubChem CID 98198614) has the molecular formula C36H37FN4O4 and a molecular weight of 608.71 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-5-[(3-methoxybenzoyl)amino]-2-[4-[(2R)-2-phenylbutanoyl]piperazin-1-yl]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-5-[(3-methoxybenzoyl)amino]-2-[4-[(2R)-2-phenylbutanoyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 98198614 |
| Molecular Formula | C36H37FN4O4 |
| Molecular Weight | 608.71 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-5-[(3-methoxybenzoyl)amino]-2-[4-[(2R)-2-phenylbutanoyl]piperazin-1-yl]benzamide |
| SMILES | CC[C@@H](C(=O)N1CCN(c2ccc(NC(=O)c3cccc(OC)c3)cc2C(=O)NCc2ccc(F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C36H37FN4O4/c1-3-31(26-8-5-4-6-9-26)36(44)41-20-18-40(19-21-41)33-17-16-29(39-34(42)27-10-7-11-30(22-27)45-2)23-32(33)35(43)38-24-25-12-14-28(37)15-13-25/h4-17,22-23,31H,3,18-21,24H2,1-2H3,(H,38,43)(H,39,42)/t31-/m1/s1 |
| InChIKey | RMNPFCSRZNRXPJ-WJOKGBTCSA-N |
| XLogP | 5.86 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.71 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|