C32H38FN5O3 — CID 98369641
5-(ethylcarbamoylamino)-N-[(4-fluorophenyl)methyl]-2-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]benzamide (PubChem CID 98369641) has the molecular formula C32H38FN5O3 and a molecular weight of 559.69 g/mol. Its IUPAC name is 5-(ethylcarbamoylamino)-N-[(4-fluorophenyl)methyl]-2-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]benzamide.
| Compound Name | 5-(ethylcarbamoylamino)-N-[(4-fluorophenyl)methyl]-2-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 98369641 |
| Molecular Formula | C32H38FN5O3 |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | 5-(ethylcarbamoylamino)-N-[(4-fluorophenyl)methyl]-2-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]benzamide |
| SMILES | CCNC(=O)Nc1ccc(N2CCCN(C(=O)[C@@H](CC)c3ccccc3)CC2)c(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C32H38FN5O3/c1-3-27(24-9-6-5-7-10-24)31(40)38-18-8-17-37(19-20-38)29-16-15-26(36-32(41)34-4-2)21-28(29)30(39)35-22-23-11-13-25(33)14-12-23/h5-7,9-16,21,27H,3-4,8,17-20,22H2,1-2H3,(H,35,39)(H2,34,36,41)/t27-/m0/s1 |
| InChIKey | FSRIXGLJCZCGHU-MHZLTWQESA-N |
| XLogP | 5.13 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|