C32H35FN4O3 — CID 42671961
3-fluoro-N-[4-[4-(2-phenylbutanoyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]benzamide (PubChem CID 42671961) has the molecular formula C32H35FN4O3 and a molecular weight of 542.66 g/mol. Its IUPAC name is 3-fluoro-N-[4-[4-(2-phenylbutanoyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 3-fluoro-N-[4-[4-(2-phenylbutanoyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 42671961 |
| Molecular Formula | C32H35FN4O3 |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 3-fluoro-N-[4-[4-(2-phenylbutanoyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]benzamide |
| SMILES | CCC(C(=O)N1CCN(c2ccc(NC(=O)c3cccc(F)c3)cc2C(=O)N2CCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C32H35FN4O3/c1-2-27(23-9-4-3-5-10-23)31(39)37-19-17-35(18-20-37)29-14-13-26(22-28(29)32(40)36-15-6-7-16-36)34-30(38)24-11-8-12-25(33)21-24/h3-5,8-14,21-22,27H,2,6-7,15-20H2,1H3,(H,34,38) |
| InChIKey | YVTLGUQOVCYMQX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|