C32H42N4O3 — CID 93144697
N-[4-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]cyclobutanecarboxamide (PubChem CID 93144697) has the molecular formula C32H42N4O3 and a molecular weight of 530.71 g/mol. Its IUPAC name is N-[4-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]cyclobutanecarboxamide.
| Compound Name | N-[4-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 93144697 |
| Molecular Formula | C32H42N4O3 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | N-[4-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]cyclobutanecarboxamide |
| SMILES | CC[C@H](C(=O)N1CCCN(c2ccc(NC(=O)C3CCC3)cc2C(=O)N2CCCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C32H42N4O3/c1-2-27(24-11-5-3-6-12-24)31(38)36-20-10-19-34(21-22-36)29-16-15-26(33-30(37)25-13-9-14-25)23-28(29)32(39)35-17-7-4-8-18-35/h3,5-6,11-12,15-16,23,25,27H,2,4,7-10,13-14,17-22H2,1H3,(H,33,37)/t27-/m0/s1 |
| InChIKey | PBOMJLHEGTTYOS-MHZLTWQESA-N |
| XLogP | 5.28 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|