C32H38N4O3 — CID 93142319
5-acetamido-N-benzyl-N-methyl-2-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]benzamide (PubChem CID 93142319) has the molecular formula C32H38N4O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is 5-acetamido-N-benzyl-N-methyl-2-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]benzamide.
| Compound Name | 5-acetamido-N-benzyl-N-methyl-2-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 93142319 |
| Molecular Formula | C32H38N4O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 5-acetamido-N-benzyl-N-methyl-2-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]benzamide |
| SMILES | CC[C@H](C(=O)N1CCCN(c2ccc(NC(C)=O)cc2C(=O)N(C)Cc2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C32H38N4O3/c1-4-28(26-14-9-6-10-15-26)32(39)36-19-11-18-35(20-21-36)30-17-16-27(33-24(2)37)22-29(30)31(38)34(3)23-25-12-7-5-8-13-25/h5-10,12-17,22,28H,4,11,18-21,23H2,1-3H3,(H,33,37)/t28-/m0/s1 |
| InChIKey | NRWZUAXJETXUTH-NDEPHWFRSA-N |
| XLogP | 5.15 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|