C32H40N4O4S — CID 42675571
N-benzyl-N-methyl-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]-5-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 42675571) has the molecular formula C32H40N4O4S and a molecular weight of 576.76 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]-5-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-benzyl-N-methyl-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]-5-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 42675571 |
| Molecular Formula | C32H40N4O4S |
| Molecular Weight | 576.76 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | N-benzyl-N-methyl-2-[4-(3-methylbutanoyl)-1,4-diazepan-1-yl]-5-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCCN(C(=O)CC(C)C)CC3)c(C(=O)N(C)Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C32H40N4O4S/c1-24(2)21-31(37)36-18-8-17-35(19-20-36)30-16-13-27(33-41(39,40)28-14-11-25(3)12-15-28)22-29(30)32(38)34(4)23-26-9-6-5-7-10-26/h5-7,9-16,22,24,33H,8,17-21,23H2,1-4H3 |
| InChIKey | IYBBZCOTNIIMHG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.76 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|