C35H34N4O5 — CID 42822176
N-[3-[benzyl(methyl)carbamoyl]-4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 42822176) has the molecular formula C35H34N4O5 and a molecular weight of 590.68 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)carbamoyl]-4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)carbamoyl]-4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42822176 |
| Molecular Formula | C35H34N4O5 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | N-[3-[benzyl(methyl)carbamoyl]-4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCN(c3ccc(NC(=O)c4ccc5c(c4)OCO5)cc3C(=O)N(C)Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C35H34N4O5/c1-24-8-10-26(11-9-24)34(41)39-18-16-38(17-19-39)30-14-13-28(36-33(40)27-12-15-31-32(20-27)44-23-43-31)21-29(30)35(42)37(2)22-25-6-4-3-5-7-25/h3-15,20-21H,16-19,22-23H2,1-2H3,(H,36,40) |
| InChIKey | MQTRJBRQEVRYGK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|