C35H34F3N5O3 — CID 42673346
4-[2-[benzyl(methyl)carbamoyl]-4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]-N-(3-methylphenyl)piperazine-1-carboxamide (PubChem CID 42673346) has the molecular formula C35H34F3N5O3 and a molecular weight of 629.68 g/mol. Its IUPAC name is 4-[2-[benzyl(methyl)carbamoyl]-4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]-N-(3-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-[benzyl(methyl)carbamoyl]-4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]-N-(3-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42673346 |
| Molecular Formula | C35H34F3N5O3 |
| Molecular Weight | 629.68 g/mol |
| Exact Mass | 629.26 |
| IUPAC Name | 4-[2-[benzyl(methyl)carbamoyl]-4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]-N-(3-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCN(c3ccc(NC(=O)c4ccc(C(F)(F)F)cc4)cc3C(=O)N(C)Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C35H34F3N5O3/c1-24-7-6-10-28(21-24)40-34(46)43-19-17-42(18-20-43)31-16-15-29(39-32(44)26-11-13-27(14-12-26)35(36,37)38)22-30(31)33(45)41(2)23-25-8-4-3-5-9-25/h3-16,21-22H,17-20,23H2,1-2H3,(H,39,44)(H,40,46) |
| InChIKey | DRKCCCHFPDWMCX-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|