C30H34N4O4 — CID 42673175
N-benzyl-2-[4-(4-methoxybenzoyl)piperazin-1-yl]-N-methyl-5-(propanoylamino)benzamide (PubChem CID 42673175) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is N-benzyl-2-[4-(4-methoxybenzoyl)piperazin-1-yl]-N-methyl-5-(propanoylamino)benzamide.
| Compound Name | N-benzyl-2-[4-(4-methoxybenzoyl)piperazin-1-yl]-N-methyl-5-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 42673175 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | N-benzyl-2-[4-(4-methoxybenzoyl)piperazin-1-yl]-N-methyl-5-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1ccc(N2CCN(C(=O)c3ccc(OC)cc3)CC2)c(C(=O)N(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C30H34N4O4/c1-4-28(35)31-24-12-15-27(26(20-24)30(37)32(2)21-22-8-6-5-7-9-22)33-16-18-34(19-17-33)29(36)23-10-13-25(38-3)14-11-23/h5-15,20H,4,16-19,21H2,1-3H3,(H,31,35) |
| InChIKey | FRLFALUEGXTZCP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|