C37H38N4O5 — CID 98232532
N-[3-[benzyl(methyl)carbamoyl]-4-[4-[(2S)-2-phenylbutanoyl]piperazin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 98232532) has the molecular formula C37H38N4O5 and a molecular weight of 618.73 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)carbamoyl]-4-[4-[(2S)-2-phenylbutanoyl]piperazin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)carbamoyl]-4-[4-[(2S)-2-phenylbutanoyl]piperazin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 98232532 |
| Molecular Formula | C37H38N4O5 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | N-[3-[benzyl(methyl)carbamoyl]-4-[4-[(2S)-2-phenylbutanoyl]piperazin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC[C@H](C(=O)N1CCN(c2ccc(NC(=O)c3ccc4c(c3)OCO4)cc2C(=O)N(C)Cc2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C37H38N4O5/c1-3-30(27-12-8-5-9-13-27)37(44)41-20-18-40(19-21-41)32-16-15-29(38-35(42)28-14-17-33-34(22-28)46-25-45-33)23-31(32)36(43)39(2)24-26-10-6-4-7-11-26/h4-17,22-23,30H,3,18-21,24-25H2,1-2H3,(H,38,42)/t30-/m0/s1 |
| InChIKey | CRNKQGXQFCPWDM-PMERELPUSA-N |
| XLogP | 5.78 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|