C33H31ClN4O3 — CID 42673473
5-benzamido-N-benzyl-2-[4-(4-chlorobenzoyl)piperazin-1-yl]-N-methylbenzamide (PubChem CID 42673473) has the molecular formula C33H31ClN4O3 and a molecular weight of 567.09 g/mol. Its IUPAC name is 5-benzamido-N-benzyl-2-[4-(4-chlorobenzoyl)piperazin-1-yl]-N-methylbenzamide.
| Compound Name | 5-benzamido-N-benzyl-2-[4-(4-chlorobenzoyl)piperazin-1-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 42673473 |
| Molecular Formula | C33H31ClN4O3 |
| Molecular Weight | 567.09 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | 5-benzamido-N-benzyl-2-[4-(4-chlorobenzoyl)piperazin-1-yl]-N-methylbenzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cc(NC(=O)c2ccccc2)ccc1N1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C33H31ClN4O3/c1-36(23-24-8-4-2-5-9-24)33(41)29-22-28(35-31(39)25-10-6-3-7-11-25)16-17-30(29)37-18-20-38(21-19-37)32(40)26-12-14-27(34)15-13-26/h2-17,22H,18-21,23H2,1H3,(H,35,39) |
| InChIKey | CVLAIKNYRLEWNI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.09 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|