C29H35N5O3S — CID 42673301
4-[2-[benzyl(methyl)carbamoyl]-4-(thiophene-2-carbonylamino)phenyl]-N-tert-butylpiperazine-1-carboxamide (PubChem CID 42673301) has the molecular formula C29H35N5O3S and a molecular weight of 533.70 g/mol. Its IUPAC name is 4-[2-[benzyl(methyl)carbamoyl]-4-(thiophene-2-carbonylamino)phenyl]-N-tert-butylpiperazine-1-carboxamide.
| Compound Name | 4-[2-[benzyl(methyl)carbamoyl]-4-(thiophene-2-carbonylamino)phenyl]-N-tert-butylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42673301 |
| Molecular Formula | C29H35N5O3S |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 4-[2-[benzyl(methyl)carbamoyl]-4-(thiophene-2-carbonylamino)phenyl]-N-tert-butylpiperazine-1-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cc(NC(=O)c2cccs2)ccc1N1CCN(C(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C29H35N5O3S/c1-29(2,3)31-28(37)34-16-14-33(15-17-34)24-13-12-22(30-26(35)25-11-8-18-38-25)19-23(24)27(36)32(4)20-21-9-6-5-7-10-21/h5-13,18-19H,14-17,20H2,1-4H3,(H,30,35)(H,31,37) |
| InChIKey | GWNMUCFVWWXIMP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|