C33H39N5O3 — CID 42673345
4-[2-[benzyl(methyl)carbamoyl]-4-(cyclopentanecarbonylamino)phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide (PubChem CID 42673345) has the molecular formula C33H39N5O3 and a molecular weight of 553.71 g/mol. Its IUPAC name is 4-[2-[benzyl(methyl)carbamoyl]-4-(cyclopentanecarbonylamino)phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-[benzyl(methyl)carbamoyl]-4-(cyclopentanecarbonylamino)phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42673345 |
| Molecular Formula | C33H39N5O3 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | 4-[2-[benzyl(methyl)carbamoyl]-4-(cyclopentanecarbonylamino)phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCN(c3ccc(NC(=O)C4CCCC4)cc3C(=O)N(C)Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C33H39N5O3/c1-24-12-14-27(15-13-24)35-33(41)38-20-18-37(19-21-38)30-17-16-28(34-31(39)26-10-6-7-11-26)22-29(30)32(40)36(2)23-25-8-4-3-5-9-25/h3-5,8-9,12-17,22,26H,6-7,10-11,18-21,23H2,1-2H3,(H,34,39)(H,35,41) |
| InChIKey | IBJPIQUGBKFTOT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|