C32H39N5O3 — CID 83283626
4-[2-[benzyl(methyl)carbamoyl]-4-[(4-methylbenzoyl)amino]phenyl]-N-propan-2-yl-1,4-diazepane-1-carboxamide (PubChem CID 83283626) has the molecular formula C32H39N5O3 and a molecular weight of 541.70 g/mol. Its IUPAC name is 4-[2-[benzyl(methyl)carbamoyl]-4-[(4-methylbenzoyl)amino]phenyl]-N-propan-2-yl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[2-[benzyl(methyl)carbamoyl]-4-[(4-methylbenzoyl)amino]phenyl]-N-propan-2-yl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 83283626 |
| Molecular Formula | C32H39N5O3 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | 4-[2-[benzyl(methyl)carbamoyl]-4-[(4-methylbenzoyl)amino]phenyl]-N-propan-2-yl-1,4-diazepane-1-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCCN(C(=O)NC(C)C)CC3)c(C(=O)N(C)Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C32H39N5O3/c1-23(2)33-32(40)37-18-8-17-36(19-20-37)29-16-15-27(34-30(38)26-13-11-24(3)12-14-26)21-28(29)31(39)35(4)22-25-9-6-5-7-10-25/h5-7,9-16,21,23H,8,17-20,22H2,1-4H3,(H,33,40)(H,34,38) |
| InChIKey | AOYGMLFWXKJUSZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|