C33H34N4O4S — CID 42675329
N-[3-[benzyl(methyl)carbamoyl]-4-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide (PubChem CID 42675329) has the molecular formula C33H34N4O4S and a molecular weight of 582.73 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)carbamoyl]-4-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)carbamoyl]-4-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42675329 |
| Molecular Formula | C33H34N4O4S |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | N-[3-[benzyl(methyl)carbamoyl]-4-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCCN(c3ccc(NC(=O)c4cccs4)cc3C(=O)N(C)Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C33H34N4O4S/c1-35(23-24-8-4-3-5-9-24)33(40)28-22-26(34-31(38)30-10-6-21-42-30)13-16-29(28)36-17-7-18-37(20-19-36)32(39)25-11-14-27(41-2)15-12-25/h3-6,8-16,21-22H,7,17-20,23H2,1-2H3,(H,34,38) |
| InChIKey | WPIIVXFHWLILIV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|