C26H34N4O4 — CID 42675192
5-acetamido-N,N-diethyl-2-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]benzamide (PubChem CID 42675192) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 5-acetamido-N,N-diethyl-2-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]benzamide.
| Compound Name | 5-acetamido-N,N-diethyl-2-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 42675192 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 5-acetamido-N,N-diethyl-2-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(C)=O)ccc1N1CCCN(C(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C26H34N4O4/c1-5-28(6-2)26(33)23-18-21(27-19(3)31)10-13-24(23)29-14-7-15-30(17-16-29)25(32)20-8-11-22(34-4)12-9-20/h8-13,18H,5-7,14-17H2,1-4H3,(H,27,31) |
| InChIKey | YNPJYYPPGNNQCW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|